C29H37N5O6S — CID 16758438
methyl (Z,5R,6S,7Z)-7-[(1S)-1-[1-[(2S)-1-hydroxy-3-phenylpropan-2-yl]triazol-4-yl]ethoxy]imino-5-methyl-6-[(4-methylphenyl)sulfonylamino]hept-3-enoate (PubChem CID 16758438) has the molecular formula C29H37N5O6S and a molecular weight of 583.71 g/mol. Its IUPAC name is methyl (Z,5R,6S,7Z)-7-[(1S)-1-[1-[(2S)-1-hydroxy-3-phenylpropan-2-yl]triazol-4-yl]ethoxy]imino-5-methyl-6-[(4-methylphenyl)sulfonylamino]hept-3-enoate.
| Compound Name | methyl (Z,5R,6S,7Z)-7-[(1S)-1-[1-[(2S)-1-hydroxy-3-phenylpropan-2-yl]triazol-4-yl]ethoxy]imino-5-methyl-6-[(4-methylphenyl)sulfonylamino]hept-3-enoate |
|---|---|
| PubChem CID | 16758438 |
| Molecular Formula | C29H37N5O6S |
| Molecular Weight | 583.71 g/mol |
| Exact Mass | 583.25 |
| IUPAC Name | methyl (Z,5R,6S,7Z)-7-[(1S)-1-[1-[(2S)-1-hydroxy-3-phenylpropan-2-yl]triazol-4-yl]ethoxy]imino-5-methyl-6-[(4-methylphenyl)sulfonylamino]hept-3-enoate |
| SMILES | COC(=O)C/C=C\[C@@H](C)[C@@H](/C=N\O[C@@H](C)c1cn([C@H](CO)Cc2ccccc2)nn1)NS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C29H37N5O6S/c1-21-13-15-26(16-14-21)41(37,38)32-27(22(2)9-8-12-29(36)39-4)18-30-40-23(3)28-19-34(33-31-28)25(20-35)17-24-10-6-5-7-11-24/h5-11,13-16,18-19,22-23,25,27,32,35H,12,17,20H2,1-4H3/b9-8-,30-18-/t22-,23+,25+,27-/m1/s1 |
| InChIKey | ZBXQOJIKFLISLL-LEMIPYGQSA-N |
| XLogP | 3.53 |
| TPSA | 145.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.71 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|