C23H35NO7 — CID 16758486
(3aR,5S,6S,6aR)-5-[(1R)-2-[(Z)-[(2R,3R)-2,4-dimethyl-3-phenylmethoxypentylidene]amino]oxy-1-hydroxyethyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-ol (PubChem CID 16758486) has the molecular formula C23H35NO7 and a molecular weight of 437.53 g/mol. Its IUPAC name is (3aR,5S,6S,6aR)-5-[(1R)-2-[(Z)-[(2R,3R)-2,4-dimethyl-3-phenylmethoxypentylidene]amino]oxy-1-hydroxyethyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-ol.
| Compound Name | (3aR,5S,6S,6aR)-5-[(1R)-2-[(Z)-[(2R,3R)-2,4-dimethyl-3-phenylmethoxypentylidene]amino]oxy-1-hydroxyethyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-ol |
|---|---|
| PubChem CID | 16758486 |
| Molecular Formula | C23H35NO7 |
| Molecular Weight | 437.53 g/mol |
| Exact Mass | 437.24 |
| IUPAC Name | (3aR,5S,6S,6aR)-5-[(1R)-2-[(Z)-[(2R,3R)-2,4-dimethyl-3-phenylmethoxypentylidene]amino]oxy-1-hydroxyethyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-ol |
| SMILES | CC(C)[C@@H](OCc1ccccc1)[C@H](C)/C=N\OC[C@@H](O)[C@@H]1O[C@@H]2OC(C)(C)O[C@@H]2[C@H]1O |
| InChI | InChI=1S/C23H35NO7/c1-14(2)19(27-12-16-9-7-6-8-10-16)15(3)11-24-28-13-17(25)20-18(26)21-22(29-20)31-23(4,5)30-21/h6-11,14-15,17-22,25-26H,12-13H2,1-5H3/b24-11-/t15-,17-,18+,19-,20+,21-,22-/m1/s1 |
| InChIKey | FTLDCABHDXBNSD-BXEDAJGDSA-N |
| XLogP | 2.46 |
| TPSA | 98.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.53 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|