C23H33NO4 — CID 16758487
[(2S,3S,6R)-3-[(Z)-[(2R,3R)-2,4-dimethyl-3-phenylmethoxypentylidene]amino]oxy-6-prop-2-enyl-3,6-dihydro-2H-pyran-2-yl]methanol (PubChem CID 16758487) has the molecular formula C23H33NO4 and a molecular weight of 387.52 g/mol. Its IUPAC name is [(2S,3S,6R)-3-[(Z)-[(2R,3R)-2,4-dimethyl-3-phenylmethoxypentylidene]amino]oxy-6-prop-2-enyl-3,6-dihydro-2H-pyran-2-yl]methanol.
| Compound Name | [(2S,3S,6R)-3-[(Z)-[(2R,3R)-2,4-dimethyl-3-phenylmethoxypentylidene]amino]oxy-6-prop-2-enyl-3,6-dihydro-2H-pyran-2-yl]methanol |
|---|---|
| PubChem CID | 16758487 |
| Molecular Formula | C23H33NO4 |
| Molecular Weight | 387.52 g/mol |
| Exact Mass | 387.24 |
| IUPAC Name | [(2S,3S,6R)-3-[(Z)-[(2R,3R)-2,4-dimethyl-3-phenylmethoxypentylidene]amino]oxy-6-prop-2-enyl-3,6-dihydro-2H-pyran-2-yl]methanol |
| SMILES | C=CC[C@@H]1C=C[C@H](O/N=C\[C@@H](C)[C@H](OCc2ccccc2)C(C)C)[C@H](CO)O1 |
| InChI | InChI=1S/C23H33NO4/c1-5-9-20-12-13-21(22(15-25)27-20)28-24-14-18(4)23(17(2)3)26-16-19-10-7-6-8-11-19/h5-8,10-14,17-18,20-23,25H,1,9,15-16H2,2-4H3/b24-14-/t18-,20-,21+,22+,23-/m1/s1 |
| InChIKey | AJOILXIULYOGMB-JUPWYWIBSA-N |
| XLogP | 4.13 |
| TPSA | 60.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.52 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|