C22H32N4O4 — CID 16758488
(3R,4R)-4-[4-[(1S)-1-[(Z)-[(2R,3R)-2,4-dimethyl-3-phenylmethoxypentylidene]amino]oxyethyl]triazol-1-yl]oxolan-3-ol (PubChem CID 16758488) has the molecular formula C22H32N4O4 and a molecular weight of 416.52 g/mol. Its IUPAC name is (3R,4R)-4-[4-[(1S)-1-[(Z)-[(2R,3R)-2,4-dimethyl-3-phenylmethoxypentylidene]amino]oxyethyl]triazol-1-yl]oxolan-3-ol.
| Compound Name | (3R,4R)-4-[4-[(1S)-1-[(Z)-[(2R,3R)-2,4-dimethyl-3-phenylmethoxypentylidene]amino]oxyethyl]triazol-1-yl]oxolan-3-ol |
|---|---|
| PubChem CID | 16758488 |
| Molecular Formula | C22H32N4O4 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.24 |
| IUPAC Name | (3R,4R)-4-[4-[(1S)-1-[(Z)-[(2R,3R)-2,4-dimethyl-3-phenylmethoxypentylidene]amino]oxyethyl]triazol-1-yl]oxolan-3-ol |
| SMILES | CC(C)[C@@H](OCc1ccccc1)[C@H](C)/C=N\O[C@@H](C)c1cn([C@@H]2COC[C@@H]2O)nn1 |
| InChI | InChI=1S/C22H32N4O4/c1-15(2)22(29-12-18-8-6-5-7-9-18)16(3)10-23-30-17(4)19-11-26(25-24-19)20-13-28-14-21(20)27/h5-11,15-17,20-22,27H,12-14H2,1-4H3/b23-10-/t16-,17+,20-,21+,22-/m1/s1 |
| InChIKey | QCRIWDZYVRHGEB-COTWTFIVSA-N |
| XLogP | 3.15 |
| TPSA | 90.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|