C14H14N4O — CID 167585017
4-methylidene-1-(3-methylquinoxalin-2-yl)-1,3-diazinan-2-one (PubChem CID 167585017) has the molecular formula C14H14N4O and a molecular weight of 254.29 g/mol. Its IUPAC name is 4-methylidene-1-(3-methylquinoxalin-2-yl)-1,3-diazinan-2-one.
| Compound Name | 4-methylidene-1-(3-methylquinoxalin-2-yl)-1,3-diazinan-2-one |
|---|---|
| PubChem CID | 167585017 |
| Molecular Formula | C14H14N4O |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | 4-methylidene-1-(3-methylquinoxalin-2-yl)-1,3-diazinan-2-one |
| SMILES | C=C1CCN(c2nc3ccccc3nc2C)C(=O)N1 |
| InChI | InChI=1S/C14H14N4O/c1-9-7-8-18(14(19)15-9)13-10(2)16-11-5-3-4-6-12(11)17-13/h3-6H,1,7-8H2,2H3,(H,15,19) |
| InChIKey | ZQSVNHHUGAITLA-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |