C24H37NO5 — CID 16758516
methyl (Z,5R,6S,7Z)-7-[(2R,3R)-2,4-dimethyl-3-phenylmethoxypentoxy]imino-6-methoxy-5-methylhept-3-enoate (PubChem CID 16758516) has the molecular formula C24H37NO5 and a molecular weight of 419.56 g/mol. Its IUPAC name is methyl (Z,5R,6S,7Z)-7-[(2R,3R)-2,4-dimethyl-3-phenylmethoxypentoxy]imino-6-methoxy-5-methylhept-3-enoate.
| Compound Name | methyl (Z,5R,6S,7Z)-7-[(2R,3R)-2,4-dimethyl-3-phenylmethoxypentoxy]imino-6-methoxy-5-methylhept-3-enoate |
|---|---|
| PubChem CID | 16758516 |
| Molecular Formula | C24H37NO5 |
| Molecular Weight | 419.56 g/mol |
| Exact Mass | 419.27 |
| IUPAC Name | methyl (Z,5R,6S,7Z)-7-[(2R,3R)-2,4-dimethyl-3-phenylmethoxypentoxy]imino-6-methoxy-5-methylhept-3-enoate |
| SMILES | COC(=O)C/C=C\[C@@H](C)[C@@H](/C=N\OC[C@@H](C)[C@H](OCc1ccccc1)C(C)C)OC |
| InChI | InChI=1S/C24H37NO5/c1-18(2)24(29-17-21-12-8-7-9-13-21)20(4)16-30-25-15-22(27-5)19(3)11-10-14-23(26)28-6/h7-13,15,18-20,22,24H,14,16-17H2,1-6H3/b11-10-,25-15-/t19-,20-,22-,24-/m1/s1 |
| InChIKey | ZRUNELAMTAVAFY-DJJSMGCDSA-N |
| XLogP | 4.64 |
| TPSA | 66.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.56 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|