C10H8O5 — CID 16758523
(1aR,2R,7aS)-2-hydroxy-5-methyl-2,7a-dihydro-1aH-oxireno[2,3-g]isochromene-3,7-dione (PubChem CID 16758523) has the molecular formula C10H8O5 and a molecular weight of 208.17 g/mol. Its IUPAC name is (1aR,2R,7aS)-2-hydroxy-5-methyl-2,7a-dihydro-1aH-oxireno[2,3-g]isochromene-3,7-dione.
| Compound Name | (1aR,2R,7aS)-2-hydroxy-5-methyl-2,7a-dihydro-1aH-oxireno[2,3-g]isochromene-3,7-dione |
|---|---|
| PubChem CID | 16758523 |
| Molecular Formula | C10H8O5 |
| Molecular Weight | 208.17 g/mol |
| Exact Mass | 208.04 |
| IUPAC Name | (1aR,2R,7aS)-2-hydroxy-5-methyl-2,7a-dihydro-1aH-oxireno[2,3-g]isochromene-3,7-dione |
| SMILES | Cc1cc2c(c(=O)o1)[C@@H](O)[C@H]1O[C@@H]1C2=O |
| InChI | InChI=1S/C10H8O5/c1-3-2-4-5(10(13)14-3)7(12)9-8(15-9)6(4)11/h2,7-9,12H,1H3/t7-,8-,9-/m1/s1 |
| InChIKey | RCTQINMBQHWRCE-IWSPIJDZSA-N |
| XLogP | -0.05 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.17 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|