About (4S,5S)-4-hydroxy-5-[(2R,3S)-3-methoxy-4-methylpentan-2-yl]oxolan-2-one
(4S,5S)-4-hydroxy-5-[(2R,3S)-3-methoxy-4-methylpentan-2-yl]oxolan-2-one (PubChem CID 16758533) has the molecular formula C11H20O4
and a molecular weight of 216.27 g/mol. Its IUPAC name is (4S,5S)-4-hydroxy-5-[(2R,3S)-3-methoxy-4-methylpentan-2-yl]oxolan-2-one.
Molecular Properties
| Compound Name | (4S,5S)-4-hydroxy-5-[(2R,3S)-3-methoxy-4-methylpentan-2-yl]oxolan-2-one |
| PubChem CID | 16758533 |
| Molecular Formula | C11H20O4 |
| Molecular Weight | 216.27 g/mol |
| Exact Mass | 216.14 |
| IUPAC Name | (4S,5S)-4-hydroxy-5-[(2R,3S)-3-methoxy-4-methylpentan-2-yl]oxolan-2-one |
| SMILES | C[C@@H]([C@H]1[C@H](CC(=O)O1)O)[C@H](C(C)C)OC |
| InChI | InChI=1S/C11H20O4/c1-6(2)10(14-4)7(3)11-8(12)5-9(13)15-11/h6-8,10-12H,5H2,1-4H3/t7-,8+,10+,11+/m1/s1 |
| InChIKey | PUPQCYXVESPHOD-IFFSRLJSSA-N |
| XLogP | 1.30 |
| TPSA | 55.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | 227 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.27 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (4S,5S)-4-hydroxy-5-[(2R,3S)-3-methoxy-4-methylpentan-2-yl]oxolan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S,5S)-4-hydroxy-5-[(2R,3S)-3-methoxy-4-methylpentan-2-yl]oxolan-2-one?
The IUPAC name of (4S,5S)-4-hydroxy-5-[(2R,3S)-3-methoxy-4-methylpentan-2-yl]oxolan-2-one (CID 16758533) is (4S,5S)-4-hydroxy-5-[(2R,3S)-3-methoxy-4-methylpentan-2-yl]oxolan-2-one.
What is the SMILES notation for (4S,5S)-4-hydroxy-5-[(2R,3S)-3-methoxy-4-methylpentan-2-yl]oxolan-2-one?
The canonical SMILES for (4S,5S)-4-hydroxy-5-[(2R,3S)-3-methoxy-4-methylpentan-2-yl]oxolan-2-one is C[C@@H]([C@H]1[C@H](CC(=O)O1)O)[C@H](C(C)C)OC.
What is the InChIKey of (4S,5S)-4-hydroxy-5-[(2R,3S)-3-methoxy-4-methylpentan-2-yl]oxolan-2-one?
The InChIKey is PUPQCYXVESPHOD-IFFSRLJSSA-N. The full InChI is InChI=1S/C11H20O4/c1-6(2)10(14-4)7(3)11-8(12)5-9(13)15-11/h6-8,10-12H,5H2,1-4H3/t7-,8+,10+,11+/m1/s1.
What are the key properties of (4S,5S)-4-hydroxy-5-[(2R,3S)-3-methoxy-4-methylpentan-2-yl]oxolan-2-one?
(4S,5S)-4-hydroxy-5-[(2R,3S)-3-methoxy-4-methylpentan-2-yl]oxolan-2-one has a molecular weight of 216.27 g/mol, XLogP of 1.30, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4S,5S)-4-hydroxy-5-[(2R,3S)-3-methoxy-4-methylpentan-2-yl]oxolan-2-one is sourced from PubChem (CID 16758533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).