C25H42O6 — CID 16758548
(1R,3S,5S,7S,9S,13R,15S,18S)-7-hydroxy-3-methoxy-18-methyl-13-[(Z)-4-methylpent-1-enyl]-12,19,20-trioxatricyclo[13.3.1.15,9]icosan-11-one (PubChem CID 16758548) has the molecular formula C25H42O6 and a molecular weight of 438.61 g/mol. Its IUPAC name is (1R,3S,5S,7S,9S,13R,15S,18S)-7-hydroxy-3-methoxy-18-methyl-13-[(Z)-4-methylpent-1-enyl]-12,19,20-trioxatricyclo[13.3.1.15,9]icosan-11-one.
| Compound Name | (1R,3S,5S,7S,9S,13R,15S,18S)-7-hydroxy-3-methoxy-18-methyl-13-[(Z)-4-methylpent-1-enyl]-12,19,20-trioxatricyclo[13.3.1.15,9]icosan-11-one |
|---|---|
| PubChem CID | 16758548 |
| Molecular Formula | C25H42O6 |
| Molecular Weight | 438.61 g/mol |
| Exact Mass | 438.30 |
| IUPAC Name | (1R,3S,5S,7S,9S,13R,15S,18S)-7-hydroxy-3-methoxy-18-methyl-13-[(Z)-4-methylpent-1-enyl]-12,19,20-trioxatricyclo[13.3.1.15,9]icosan-11-one |
| SMILES | CO[C@H]1C[C@@H]2C[C@H](O)C[C@@H](CC(=O)O[C@@H](/C=C\CC(C)C)C[C@@H]3CC[C@H](C)[C@@H](C1)O3)O2 |
| InChI | InChI=1S/C25H42O6/c1-16(2)6-5-7-19-12-20-9-8-17(3)24(30-20)14-21(28-4)13-22-10-18(26)11-23(29-22)15-25(27)31-19/h5,7,16-24,26H,6,8-15H2,1-4H3/b7-5-/t17-,18-,19-,20-,21-,22-,23-,24+/m0/s1 |
| InChIKey | YSOZAHZPGSVKPC-IZNGWIQMSA-N |
| XLogP | 4.18 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.61 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|