About (2R,3R)-3-hydroxy-7-methoxy-2-[3-(trifluoromethyl)phenyl]-2,3-dihydrochromen-4-one
(2R,3R)-3-hydroxy-7-methoxy-2-[3-(trifluoromethyl)phenyl]-2,3-dihydrochromen-4-one (PubChem CID 16758558) has the molecular formula C17H13F3O4
and a molecular weight of 338.28 g/mol. Its IUPAC name is (2R,3R)-3-hydroxy-7-methoxy-2-[3-(trifluoromethyl)phenyl]-2,3-dihydrochromen-4-one.
Molecular Properties
| Compound Name | (2R,3R)-3-hydroxy-7-methoxy-2-[3-(trifluoromethyl)phenyl]-2,3-dihydrochromen-4-one |
| PubChem CID | 16758558 |
| Molecular Formula | C17H13F3O4 |
| Molecular Weight | 338.28 g/mol |
| Exact Mass | 338.08 |
| IUPAC Name | (2R,3R)-3-hydroxy-7-methoxy-2-[3-(trifluoromethyl)phenyl]-2,3-dihydrochromen-4-one |
| SMILES | COc1ccc2c(c1)O[C@H](c1cccc(C(F)(F)F)c1)[C@@H](O)C2=O |
| InChI | InChI=1S/C17H13F3O4/c1-23-11-5-6-12-13(8-11)24-16(15(22)14(12)21)9-3-2-4-10(7-9)17(18,19)20/h2-8,15-16,22H,1H3/t15-,16+/m0/s1 |
| InChIKey | BURAIKRKMDXXHD-JKSUJKDBSA-N |
| XLogP | 3.39 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.28 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2R,3R)-3-hydroxy-7-methoxy-2-[3-(trifluoromethyl)phenyl]-2,3-dihydrochromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,3R)-3-hydroxy-7-methoxy-2-[3-(trifluoromethyl)phenyl]-2,3-dihydrochromen-4-one?
The IUPAC name of (2R,3R)-3-hydroxy-7-methoxy-2-[3-(trifluoromethyl)phenyl]-2,3-dihydrochromen-4-one (CID 16758558) is (2R,3R)-3-hydroxy-7-methoxy-2-[3-(trifluoromethyl)phenyl]-2,3-dihydrochromen-4-one.
What is the SMILES notation for (2R,3R)-3-hydroxy-7-methoxy-2-[3-(trifluoromethyl)phenyl]-2,3-dihydrochromen-4-one?
The canonical SMILES for (2R,3R)-3-hydroxy-7-methoxy-2-[3-(trifluoromethyl)phenyl]-2,3-dihydrochromen-4-one is COc1ccc2c(c1)O[C@H](c1cccc(C(F)(F)F)c1)[C@@H](O)C2=O.
What is the InChIKey of (2R,3R)-3-hydroxy-7-methoxy-2-[3-(trifluoromethyl)phenyl]-2,3-dihydrochromen-4-one?
The InChIKey is BURAIKRKMDXXHD-JKSUJKDBSA-N. The full InChI is InChI=1S/C17H13F3O4/c1-23-11-5-6-12-13(8-11)24-16(15(22)14(12)21)9-3-2-4-10(7-9)17(18,19)20/h2-8,15-16,22H,1H3/t15-,16+/m0/s1.
What are the key properties of (2R,3R)-3-hydroxy-7-methoxy-2-[3-(trifluoromethyl)phenyl]-2,3-dihydrochromen-4-one?
(2R,3R)-3-hydroxy-7-methoxy-2-[3-(trifluoromethyl)phenyl]-2,3-dihydrochromen-4-one has a molecular weight of 338.28 g/mol, XLogP of 3.39, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,3R)-3-hydroxy-7-methoxy-2-[3-(trifluoromethyl)phenyl]-2,3-dihydrochromen-4-one is sourced from PubChem (CID 16758558), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).