About (2S)-1,1-dibutoxy-3-naphthalen-2-ylsulfanylpropan-2-ol
(2S)-1,1-dibutoxy-3-naphthalen-2-ylsulfanylpropan-2-ol (PubChem CID 16758561) has the molecular formula C21H30O3S
and a molecular weight of 362.53 g/mol. Its IUPAC name is (2S)-1,1-dibutoxy-3-naphthalen-2-ylsulfanylpropan-2-ol.
Molecular Properties
| Compound Name | (2S)-1,1-dibutoxy-3-naphthalen-2-ylsulfanylpropan-2-ol |
| PubChem CID | 16758561 |
| Molecular Formula | C21H30O3S |
| Molecular Weight | 362.53 g/mol |
| Exact Mass | 362.19 |
| IUPAC Name | (2S)-1,1-dibutoxy-3-naphthalen-2-ylsulfanylpropan-2-ol |
| SMILES | CCCCOC(OCCCC)[C@H](O)CSc1ccc2ccccc2c1 |
| InChI | InChI=1S/C21H30O3S/c1-3-5-13-23-21(24-14-6-4-2)20(22)16-25-19-12-11-17-9-7-8-10-18(17)15-19/h7-12,15,20-22H,3-6,13-14,16H2,1-2H3/t20-/m1/s1 |
| InChIKey | JGPWZMAMTWHBPZ-HXUWFJFHSA-N |
| XLogP | 5.25 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 362.53 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze (2S)-1,1-dibutoxy-3-naphthalen-2-ylsulfanylpropan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-1,1-dibutoxy-3-naphthalen-2-ylsulfanylpropan-2-ol?
The IUPAC name of (2S)-1,1-dibutoxy-3-naphthalen-2-ylsulfanylpropan-2-ol (CID 16758561) is (2S)-1,1-dibutoxy-3-naphthalen-2-ylsulfanylpropan-2-ol.
What is the SMILES notation for (2S)-1,1-dibutoxy-3-naphthalen-2-ylsulfanylpropan-2-ol?
The canonical SMILES for (2S)-1,1-dibutoxy-3-naphthalen-2-ylsulfanylpropan-2-ol is CCCCOC(OCCCC)[C@H](O)CSc1ccc2ccccc2c1.
What is the InChIKey of (2S)-1,1-dibutoxy-3-naphthalen-2-ylsulfanylpropan-2-ol?
The InChIKey is JGPWZMAMTWHBPZ-HXUWFJFHSA-N. The full InChI is InChI=1S/C21H30O3S/c1-3-5-13-23-21(24-14-6-4-2)20(22)16-25-19-12-11-17-9-7-8-10-18(17)15-19/h7-12,15,20-22H,3-6,13-14,16H2,1-2H3/t20-/m1/s1.
What are the key properties of (2S)-1,1-dibutoxy-3-naphthalen-2-ylsulfanylpropan-2-ol?
(2S)-1,1-dibutoxy-3-naphthalen-2-ylsulfanylpropan-2-ol has a molecular weight of 362.53 g/mol, XLogP of 5.25, 12 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-1,1-dibutoxy-3-naphthalen-2-ylsulfanylpropan-2-ol is sourced from PubChem (CID 16758561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).