C21H21NO2 — CID 16758574
(2R,5S,6S)-5-methyl-6-[4-(2-phenylethynyl)phenyl]piperidine-2-carboxylic acid (PubChem CID 16758574) has the molecular formula C21H21NO2 and a molecular weight of 319.40 g/mol. Its IUPAC name is (2R,5S,6S)-5-methyl-6-[4-(2-phenylethynyl)phenyl]piperidine-2-carboxylic acid.
| Compound Name | (2R,5S,6S)-5-methyl-6-[4-(2-phenylethynyl)phenyl]piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 16758574 |
| Molecular Formula | C21H21NO2 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.16 |
| IUPAC Name | (2R,5S,6S)-5-methyl-6-[4-(2-phenylethynyl)phenyl]piperidine-2-carboxylic acid |
| SMILES | C[C@H]1CC[C@H](C(=O)O)N[C@@H]1c1ccc(C#Cc2ccccc2)cc1 |
| InChI | InChI=1S/C21H21NO2/c1-15-7-14-19(21(23)24)22-20(15)18-12-10-17(11-13-18)9-8-16-5-3-2-4-6-16/h2-6,10-13,15,19-20,22H,7,14H2,1H3,(H,23,24)/t15-,19+,20-/m0/s1 |
| InChIKey | XPGOTJAHXXNWDA-BEVDRBHNSA-N |
| XLogP | 3.60 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|