C46H68BN6O6PS2 — CID 167585761
CID 167585761 (PubChem CID 167585761) has the molecular formula C46H68BN6O6PS2 and a molecular weight of 907.01 g/mol.
| Compound Name | CID 167585761 |
|---|---|
| PubChem CID | 167585761 |
| Molecular Formula | C46H68BN6O6PS2 |
| Molecular Weight | 907.01 g/mol |
| Exact Mass | 906.45 |
| IUPAC Name | — |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CC1)Cc1cc(C#N)ccc1[C@H]2N[S@](=O)C(C)(C)C.CC(C)(C)OC(=O)N1CCC2(CC1)Cc1cc(C#N)ccc1[C@H]2N[S@](=O)C(C)(C)C.[B]P |
| InChI | InChI=1S/2C23H33N3O3S.BH2P/c2*1-21(2,3)29-20(27)26-11-9-23(10-12-26)14-17-13-16(15-24)7-8-18(17)19(23)25-30(28)22(4,5)6;1-2/h2*7-8,13,19,25H,9-12,14H2,1-6H3;2H2/t2*19-,30-;/m11./s1 |
| InChIKey | RNMFYLNHVGNGLB-DVGBGFJUSA-N |
| XLogP | 8.39 |
| TPSA | 164.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 907.01 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|