C9H14N4O3S — CID 167586480
(2R,3S,4S,5R)-2-(4-amino-2-methylidene-1,3,5-triazin-1-yl)-5-(hydroxymethyl)thiolane-3,4-diol (PubChem CID 167586480) has the molecular formula C9H14N4O3S and a molecular weight of 258.30 g/mol. Its IUPAC name is (2R,3S,4S,5R)-2-(4-amino-2-methylidene-1,3,5-triazin-1-yl)-5-(hydroxymethyl)thiolane-3,4-diol.
| Compound Name | (2R,3S,4S,5R)-2-(4-amino-2-methylidene-1,3,5-triazin-1-yl)-5-(hydroxymethyl)thiolane-3,4-diol |
|---|---|
| PubChem CID | 167586480 |
| Molecular Formula | C9H14N4O3S |
| Molecular Weight | 258.30 g/mol |
| Exact Mass | 258.08 |
| IUPAC Name | (2R,3S,4S,5R)-2-(4-amino-2-methylidene-1,3,5-triazin-1-yl)-5-(hydroxymethyl)thiolane-3,4-diol |
| SMILES | C=C1N=C(N)N=CN1[C@@H]1S[C@H](CO)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C9H14N4O3S/c1-4-12-9(10)11-3-13(4)8-7(16)6(15)5(2-14)17-8/h3,5-8,14-16H,1-2H2,(H2,10,12)/t5-,6-,7+,8-/m1/s1 |
| InChIKey | CXVXJTXLHIBDGC-OOJXKGFFSA-N |
| XLogP | -1.73 |
| TPSA | 114.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.30 |
| LogP ≤ 5 | -1.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |