C23H38N2O5 — CID 167587461
1-methyl-3-[4-[[(1R,4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]butyl]-2H-imidazole (PubChem CID 167587461) has the molecular formula C23H38N2O5 and a molecular weight of 422.57 g/mol. Its IUPAC name is 1-methyl-3-[4-[[(1R,4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]butyl]-2H-imidazole.
| Compound Name | 1-methyl-3-[4-[[(1R,4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]butyl]-2H-imidazole |
|---|---|
| PubChem CID | 167587461 |
| Molecular Formula | C23H38N2O5 |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.28 |
| IUPAC Name | 1-methyl-3-[4-[[(1R,4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]butyl]-2H-imidazole |
| SMILES | C[C@H]1[C@@H](OCCCCN2C=CN(C)C2)O[C@@H]2O[C@@]3(C)CC[C@H]4[C@H](C)CC[C@@H]1[C@@]24OO3 |
| InChI | InChI=1S/C23H38N2O5/c1-16-7-8-19-17(2)20(26-14-6-5-11-25-13-12-24(4)15-25)27-21-23(19)18(16)9-10-22(3,28-21)29-30-23/h12-13,16-21H,5-11,14-15H2,1-4H3/t16-,17-,18+,19+,20+,21-,22-,23-/m1/s1 |
| InChIKey | MBWJRPHSGQJIJQ-BRALBGQASA-N |
| XLogP | 3.67 |
| TPSA | 52.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|