About 2,6-dimethylheptane;N-methyl-N-propan-2-ylquinazolin-2-amine
2,6-dimethylheptane;N-methyl-N-propan-2-ylquinazolin-2-amine (PubChem CID 167588136) has the molecular formula C21H35N3
and a molecular weight of 329.53 g/mol. Its IUPAC name is 2,6-dimethylheptane;N-methyl-N-propan-2-ylquinazolin-2-amine.
Molecular Properties
| Compound Name | 2,6-dimethylheptane;N-methyl-N-propan-2-ylquinazolin-2-amine |
| PubChem CID | 167588136 |
| Molecular Formula | C21H35N3 |
| Molecular Weight | 329.53 g/mol |
| Exact Mass | 329.28 |
| IUPAC Name | 2,6-dimethylheptane;N-methyl-N-propan-2-ylquinazolin-2-amine |
| SMILES | CC(C)CCCC(C)C.CC(C)N(C)c1ncc2ccccc2n1 |
| InChI | InChI=1S/C12H15N3.C9H20/c1-9(2)15(3)12-13-8-10-6-4-5-7-11(10)14-12;1-8(2)6-5-7-9(3)4/h4-9H,1-3H3;8-9H,5-7H2,1-4H3 |
| InChIKey | IBJHDZQGNPTFDC-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 329.53 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,6-dimethylheptane;N-methyl-N-propan-2-ylquinazolin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dimethylheptane;N-methyl-N-propan-2-ylquinazolin-2-amine?
The IUPAC name of 2,6-dimethylheptane;N-methyl-N-propan-2-ylquinazolin-2-amine (CID 167588136) is 2,6-dimethylheptane;N-methyl-N-propan-2-ylquinazolin-2-amine.
What is the SMILES notation for 2,6-dimethylheptane;N-methyl-N-propan-2-ylquinazolin-2-amine?
The canonical SMILES for 2,6-dimethylheptane;N-methyl-N-propan-2-ylquinazolin-2-amine is CC(C)CCCC(C)C.CC(C)N(C)c1ncc2ccccc2n1.
What is the InChIKey of 2,6-dimethylheptane;N-methyl-N-propan-2-ylquinazolin-2-amine?
The InChIKey is IBJHDZQGNPTFDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N3.C9H20/c1-9(2)15(3)12-13-8-10-6-4-5-7-11(10)14-12;1-8(2)6-5-7-9(3)4/h4-9H,1-3H3;8-9H,5-7H2,1-4H3.
What are the key properties of 2,6-dimethylheptane;N-methyl-N-propan-2-ylquinazolin-2-amine?
2,6-dimethylheptane;N-methyl-N-propan-2-ylquinazolin-2-amine has a molecular weight of 329.53 g/mol, XLogP of 5.94, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dimethylheptane;N-methyl-N-propan-2-ylquinazolin-2-amine is sourced from PubChem (CID 167588136), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).