C23H30N2O — CID 16758851
8-methyl-2-(3-methylbutyl)-6-phenyl-1,3,4,7,8,10-hexahydropyrano[4,3-c][1,6]naphthyridine (PubChem CID 16758851) has the molecular formula C23H30N2O and a molecular weight of 350.51 g/mol. Its IUPAC name is 8-methyl-2-(3-methylbutyl)-6-phenyl-1,3,4,7,8,10-hexahydropyrano[4,3-c][1,6]naphthyridine.
| Compound Name | 8-methyl-2-(3-methylbutyl)-6-phenyl-1,3,4,7,8,10-hexahydropyrano[4,3-c][1,6]naphthyridine |
|---|---|
| PubChem CID | 16758851 |
| Molecular Formula | C23H30N2O |
| Molecular Weight | 350.51 g/mol |
| Exact Mass | 350.24 |
| IUPAC Name | 8-methyl-2-(3-methylbutyl)-6-phenyl-1,3,4,7,8,10-hexahydropyrano[4,3-c][1,6]naphthyridine |
| SMILES | CC(C)CCN1CCc2nc(-c3ccccc3)c3c(c2C1)COC(C)C3 |
| InChI | InChI=1S/C23H30N2O/c1-16(2)9-11-25-12-10-22-20(14-25)21-15-26-17(3)13-19(21)23(24-22)18-7-5-4-6-8-18/h4-8,16-17H,9-15H2,1-3H3 |
| InChIKey | AIXQLNDNGJLHFO-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.51 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |