C21H34N2O — CID 16758852
6-butyl-8-methyl-2-(3-methylbutyl)-1,3,4,7,8,10-hexahydropyrano[4,3-c][1,6]naphthyridine (PubChem CID 16758852) has the molecular formula C21H34N2O and a molecular weight of 330.52 g/mol. Its IUPAC name is 6-butyl-8-methyl-2-(3-methylbutyl)-1,3,4,7,8,10-hexahydropyrano[4,3-c][1,6]naphthyridine.
| Compound Name | 6-butyl-8-methyl-2-(3-methylbutyl)-1,3,4,7,8,10-hexahydropyrano[4,3-c][1,6]naphthyridine |
|---|---|
| PubChem CID | 16758852 |
| Molecular Formula | C21H34N2O |
| Molecular Weight | 330.52 g/mol |
| Exact Mass | 330.27 |
| IUPAC Name | 6-butyl-8-methyl-2-(3-methylbutyl)-1,3,4,7,8,10-hexahydropyrano[4,3-c][1,6]naphthyridine |
| SMILES | CCCCc1nc2c(c3c1CC(C)OC3)CN(CCC(C)C)CC2 |
| InChI | InChI=1S/C21H34N2O/c1-5-6-7-20-17-12-16(4)24-14-19(17)18-13-23(10-8-15(2)3)11-9-21(18)22-20/h15-16H,5-14H2,1-4H3 |
| InChIKey | BVSVQIFXGNUTCZ-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.52 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |