C24H32N2O2 — CID 16758854
6-(4-methoxyphenyl)-8-methyl-2-(3-methylbutyl)-1,3,4,7,8,10-hexahydropyrano[4,3-c][1,6]naphthyridine (PubChem CID 16758854) has the molecular formula C24H32N2O2 and a molecular weight of 380.53 g/mol. Its IUPAC name is 6-(4-methoxyphenyl)-8-methyl-2-(3-methylbutyl)-1,3,4,7,8,10-hexahydropyrano[4,3-c][1,6]naphthyridine.
| Compound Name | 6-(4-methoxyphenyl)-8-methyl-2-(3-methylbutyl)-1,3,4,7,8,10-hexahydropyrano[4,3-c][1,6]naphthyridine |
|---|---|
| PubChem CID | 16758854 |
| Molecular Formula | C24H32N2O2 |
| Molecular Weight | 380.53 g/mol |
| Exact Mass | 380.25 |
| IUPAC Name | 6-(4-methoxyphenyl)-8-methyl-2-(3-methylbutyl)-1,3,4,7,8,10-hexahydropyrano[4,3-c][1,6]naphthyridine |
| SMILES | COc1ccc(-c2nc3c(c4c2CC(C)OC4)CN(CCC(C)C)CC3)cc1 |
| InChI | InChI=1S/C24H32N2O2/c1-16(2)9-11-26-12-10-23-21(14-26)22-15-28-17(3)13-20(22)24(25-23)18-5-7-19(27-4)8-6-18/h5-8,16-17H,9-15H2,1-4H3 |
| InChIKey | WIMYFPKAIHZHDS-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.53 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |