C29H27N3O8 — CID 16758862
dimethyl (7S)-13-benzyl-7-hydroxy-4,12-dimethyl-3,5,8-trioxo-10-phenyl-4,9,13-triazatricyclo[7.4.0.02,6]trideca-1,11-diene-7,11-dicarboxylate (PubChem CID 16758862) has the molecular formula C29H27N3O8 and a molecular weight of 545.55 g/mol. Its IUPAC name is dimethyl (7S)-13-benzyl-7-hydroxy-4,12-dimethyl-3,5,8-trioxo-10-phenyl-4,9,13-triazatricyclo[7.4.0.02,6]trideca-1,11-diene-7,11-dicarboxylate.
| Compound Name | dimethyl (7S)-13-benzyl-7-hydroxy-4,12-dimethyl-3,5,8-trioxo-10-phenyl-4,9,13-triazatricyclo[7.4.0.02,6]trideca-1,11-diene-7,11-dicarboxylate |
|---|---|
| PubChem CID | 16758862 |
| Molecular Formula | C29H27N3O8 |
| Molecular Weight | 545.55 g/mol |
| Exact Mass | 545.18 |
| IUPAC Name | dimethyl (7S)-13-benzyl-7-hydroxy-4,12-dimethyl-3,5,8-trioxo-10-phenyl-4,9,13-triazatricyclo[7.4.0.02,6]trideca-1,11-diene-7,11-dicarboxylate |
| SMILES | COC(=O)C1=C(C)N(Cc2ccccc2)C2=C3C(=O)N(C)C(=O)C3[C@@](O)(C(=O)OC)C(=O)N2C1c1ccccc1 |
| InChI | InChI=1S/C29H27N3O8/c1-16-19(26(35)39-3)22(18-13-9-6-10-14-18)32-23(31(16)15-17-11-7-5-8-12-17)20-21(25(34)30(2)24(20)33)29(38,27(32)36)28(37)40-4/h5-14,21-22,38H,15H2,1-4H3/t21?,22?,29-/m0/s1 |
| InChIKey | IWLUPCVOQHTKBO-NRVWMRPUSA-N |
| XLogP | 1.26 |
| TPSA | 133.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.55 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|