C30H30N2O7 — CID 16758870
dimethyl (1S,8S)-14-benzyl-13-methyl-3,9-dioxo-11-phenyl-15-oxa-10,14-diazatetracyclo[6.6.1.01,10.02,7]pentadec-12-ene-8,12-dicarboxylate (PubChem CID 16758870) has the molecular formula C30H30N2O7 and a molecular weight of 530.58 g/mol. Its IUPAC name is dimethyl (1S,8S)-14-benzyl-13-methyl-3,9-dioxo-11-phenyl-15-oxa-10,14-diazatetracyclo[6.6.1.01,10.02,7]pentadec-12-ene-8,12-dicarboxylate.
| Compound Name | dimethyl (1S,8S)-14-benzyl-13-methyl-3,9-dioxo-11-phenyl-15-oxa-10,14-diazatetracyclo[6.6.1.01,10.02,7]pentadec-12-ene-8,12-dicarboxylate |
|---|---|
| PubChem CID | 16758870 |
| Molecular Formula | C30H30N2O7 |
| Molecular Weight | 530.58 g/mol |
| Exact Mass | 530.21 |
| IUPAC Name | dimethyl (1S,8S)-14-benzyl-13-methyl-3,9-dioxo-11-phenyl-15-oxa-10,14-diazatetracyclo[6.6.1.01,10.02,7]pentadec-12-ene-8,12-dicarboxylate |
| SMILES | COC(=O)C1=C(C)N(Cc2ccccc2)[C@]23O[C@](C(=O)OC)(C(=O)N2C1c1ccccc1)C1CCCC(=O)C13 |
| InChI | InChI=1S/C30H30N2O7/c1-18-23(26(34)37-2)25(20-13-8-5-9-14-20)32-27(35)29(28(36)38-3)21-15-10-16-22(33)24(21)30(32,39-29)31(18)17-19-11-6-4-7-12-19/h4-9,11-14,21,24-25H,10,15-17H2,1-3H3/t21?,24?,25?,29-,30-/m0/s1 |
| InChIKey | HMSNLNAQKOGORB-XKYPJADLSA-N |
| XLogP | 3.11 |
| TPSA | 102.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.58 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|