C29H28N2O8 — CID 16758871
dimethyl (1S,8S)-14-benzyl-13-methyl-3,9-dioxo-11-phenyl-4,15-dioxa-10,14-diazatetracyclo[6.6.1.01,10.02,7]pentadec-12-ene-8,12-dicarboxylate (PubChem CID 16758871) has the molecular formula C29H28N2O8 and a molecular weight of 532.55 g/mol. Its IUPAC name is dimethyl (1S,8S)-14-benzyl-13-methyl-3,9-dioxo-11-phenyl-4,15-dioxa-10,14-diazatetracyclo[6.6.1.01,10.02,7]pentadec-12-ene-8,12-dicarboxylate.
| Compound Name | dimethyl (1S,8S)-14-benzyl-13-methyl-3,9-dioxo-11-phenyl-4,15-dioxa-10,14-diazatetracyclo[6.6.1.01,10.02,7]pentadec-12-ene-8,12-dicarboxylate |
|---|---|
| PubChem CID | 16758871 |
| Molecular Formula | C29H28N2O8 |
| Molecular Weight | 532.55 g/mol |
| Exact Mass | 532.18 |
| IUPAC Name | dimethyl (1S,8S)-14-benzyl-13-methyl-3,9-dioxo-11-phenyl-4,15-dioxa-10,14-diazatetracyclo[6.6.1.01,10.02,7]pentadec-12-ene-8,12-dicarboxylate |
| SMILES | COC(=O)C1=C(C)N(Cc2ccccc2)[C@]23O[C@](C(=O)OC)(C(=O)N2C1c1ccccc1)C1CCOC(=O)C13 |
| InChI | InChI=1S/C29H28N2O8/c1-17-21(24(32)36-2)23(19-12-8-5-9-13-19)31-26(34)28(27(35)37-3)20-14-15-38-25(33)22(20)29(31,39-28)30(17)16-18-10-6-4-7-11-18/h4-13,20,22-23H,14-16H2,1-3H3/t20?,22?,23?,28-,29-/m0/s1 |
| InChIKey | XRHDJZBKMGSKTH-ALJWWMGFSA-N |
| XLogP | 2.31 |
| TPSA | 111.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.55 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|