About CID 167589047
CID 167589047 (PubChem CID 167589047) has the molecular formula C46H45BBrF6N6O6
and a molecular weight of 982.61 g/mol.
Molecular Properties
| Compound Name | CID 167589047 |
| PubChem CID | 167589047 |
| Molecular Formula | C46H45BBrF6N6O6 |
| Molecular Weight | 982.61 g/mol |
| Exact Mass | 981.26 |
| IUPAC Name | — |
| SMILES | COC(=O)c1ccc(Nc2cccc(C(F)(F)F)c2)c(-c2ccnc(N)c2)c1.COC(=O)c1ccc(Nc2cccc(C(F)(F)F)c2)c([B]OC(C)(C)C(C)(C)O)c1.Nc1cc(Br)ccn1 |
| InChI | InChI=1S/C21H24BF3NO4.C20H16F3N3O2.C5H5BrN2/c1-19(2,28)20(3,4)30-22-16-11-13(18(27)29-5)9-10-17(16)26-15-8-6-7-14(12-15)21(23,24)25;1-28-19(27)13-5-6-17(16(9-13)12-7-8-25-18(24)10-12)26-15-4-2-3-14(11-15)20(21,22)23;6-4-1-2-8-5(7)3-4/h6-12,26,28H,1-5H3;2-11,26H,1H3,(H2,24,25);1-3H,(H2,7,8) |
| InChIKey | GVSITTBASYGSLV-UHFFFAOYSA-N |
| XLogP | 10.35 |
| TPSA | 183.94 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 66 |
| Complexity | — |
Lipinski Rule of Five
3 violations
| Rule | Value |
| MW ≤ 500 | 982.61 |
| LogP ≤ 5 | 10.35 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 167589047 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 167589047?
The IUPAC name of CID 167589047 (CID 167589047) is not available.
What is the SMILES notation for CID 167589047?
The canonical SMILES for CID 167589047 is COC(=O)c1ccc(Nc2cccc(C(F)(F)F)c2)c(-c2ccnc(N)c2)c1.COC(=O)c1ccc(Nc2cccc(C(F)(F)F)c2)c([B]OC(C)(C)C(C)(C)O)c1.Nc1cc(Br)ccn1.
What is the InChIKey of CID 167589047?
The InChIKey is GVSITTBASYGSLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24BF3NO4.C20H16F3N3O2.C5H5BrN2/c1-19(2,28)20(3,4)30-22-16-11-13(18(27)29-5)9-10-17(16)26-15-8-6-7-14(12-15)21(23,24)25;1-28-19(27)13-5-6-17(16(9-13)12-7-8-25-18(24)10-12)26-15-4-2-3-14(11-15)20(21,22)23;6-4-1-2-8-5(7)3-4/h6-12,26,28H,1-5H3;2-11,26H,1H3,(H2,24,25);1-3H,(H2,7,8).
What are the key properties of CID 167589047?
CID 167589047 has a molecular weight of 982.61 g/mol, XLogP of 10.35, 11 rotatable bonds, 5 hydrogen bond donors, and 12 hydrogen bond acceptors.
Where does this data come from?
All data for CID 167589047 is sourced from PubChem (CID 167589047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).