C30H30N2O7 — CID 16758911
methyl (1S,8R)-14-benzyl-13-methyl-3,9-dioxo-11-phenyl-8-propanoyl-4,15-dioxa-10,14-diazatetracyclo[6.6.1.01,10.02,7]pentadec-12-ene-12-carboxylate (PubChem CID 16758911) has the molecular formula C30H30N2O7 and a molecular weight of 530.58 g/mol. Its IUPAC name is methyl (1S,8R)-14-benzyl-13-methyl-3,9-dioxo-11-phenyl-8-propanoyl-4,15-dioxa-10,14-diazatetracyclo[6.6.1.01,10.02,7]pentadec-12-ene-12-carboxylate.
| Compound Name | methyl (1S,8R)-14-benzyl-13-methyl-3,9-dioxo-11-phenyl-8-propanoyl-4,15-dioxa-10,14-diazatetracyclo[6.6.1.01,10.02,7]pentadec-12-ene-12-carboxylate |
|---|---|
| PubChem CID | 16758911 |
| Molecular Formula | C30H30N2O7 |
| Molecular Weight | 530.58 g/mol |
| Exact Mass | 530.21 |
| IUPAC Name | methyl (1S,8R)-14-benzyl-13-methyl-3,9-dioxo-11-phenyl-8-propanoyl-4,15-dioxa-10,14-diazatetracyclo[6.6.1.01,10.02,7]pentadec-12-ene-12-carboxylate |
| SMILES | CCC(=O)[C@]12O[C@@]3(C4C(=O)OCCC41)N(Cc1ccccc1)C(C)=C(C(=O)OC)C(c1ccccc1)N3C2=O |
| InChI | InChI=1S/C30H30N2O7/c1-4-22(33)29-21-15-16-38-27(35)24(21)30(39-29)31(17-19-11-7-5-8-12-19)18(2)23(26(34)37-3)25(32(30)28(29)36)20-13-9-6-10-14-20/h5-14,21,24-25H,4,15-17H2,1-3H3/t21?,24?,25?,29-,30+/m1/s1 |
| InChIKey | ZJKRSKDXJUJFDW-VUGZBWBSSA-N |
| XLogP | 3.11 |
| TPSA | 102.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.58 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|