C20H32O4 — CID 16758921
4,6,8-trimethoxy-3,5,7-trimethyl-8-phenyloctan-2-one (PubChem CID 16758921) has the molecular formula C20H32O4 and a molecular weight of 336.47 g/mol. Its IUPAC name is 4,6,8-trimethoxy-3,5,7-trimethyl-8-phenyloctan-2-one.
| Compound Name | 4,6,8-trimethoxy-3,5,7-trimethyl-8-phenyloctan-2-one |
|---|---|
| PubChem CID | 16758921 |
| Molecular Formula | C20H32O4 |
| Molecular Weight | 336.47 g/mol |
| Exact Mass | 336.23 |
| IUPAC Name | 4,6,8-trimethoxy-3,5,7-trimethyl-8-phenyloctan-2-one |
| SMILES | COC(c1ccccc1)C(C)C(OC)C(C)C(OC)C(C)C(C)=O |
| InChI | InChI=1S/C20H32O4/c1-13(16(4)21)18(22-5)14(2)19(23-6)15(3)20(24-7)17-11-9-8-10-12-17/h8-15,18-20H,1-7H3 |
| InChIKey | WPRYXYGHRKNLKD-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.47 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |