C17H16BrClN4O — CID 167589219
5-bromo-3-chloro-N-[(1R,2R)-7-cyano-7-azabicyclo[2.2.1]heptan-2-yl]-1-methylindole-2-carboxamide (PubChem CID 167589219) has the molecular formula C17H16BrClN4O and a molecular weight of 407.70 g/mol. Its IUPAC name is 5-bromo-3-chloro-N-[(1R,2R)-7-cyano-7-azabicyclo[2.2.1]heptan-2-yl]-1-methylindole-2-carboxamide.
| Compound Name | 5-bromo-3-chloro-N-[(1R,2R)-7-cyano-7-azabicyclo[2.2.1]heptan-2-yl]-1-methylindole-2-carboxamide |
|---|---|
| PubChem CID | 167589219 |
| Molecular Formula | C17H16BrClN4O |
| Molecular Weight | 407.70 g/mol |
| Exact Mass | 406.02 |
| IUPAC Name | 5-bromo-3-chloro-N-[(1R,2R)-7-cyano-7-azabicyclo[2.2.1]heptan-2-yl]-1-methylindole-2-carboxamide |
| SMILES | Cn1c(C(=O)N[C@@H]2CC3CC[C@H]2N3C#N)c(Cl)c2cc(Br)ccc21 |
| InChI | InChI=1S/C17H16BrClN4O/c1-22-13-4-2-9(18)6-11(13)15(19)16(22)17(24)21-12-7-10-3-5-14(12)23(10)8-20/h2,4,6,10,12,14H,3,5,7H2,1H3,(H,21,24)/t10?,12-,14-/m1/s1 |
| InChIKey | IEYUDTKCMPGSOV-HCGVIMEBSA-N |
| XLogP | 3.41 |
| TPSA | 61.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.70 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|