C19H26O6 — CID 16758928
[3-acetyloxy-6-[2-(1-methoxycyclohexyl)ethynyl]-3,6-dihydro-2H-pyran-2-yl]methyl acetate (PubChem CID 16758928) has the molecular formula C19H26O6 and a molecular weight of 350.41 g/mol. Its IUPAC name is [3-acetyloxy-6-[2-(1-methoxycyclohexyl)ethynyl]-3,6-dihydro-2H-pyran-2-yl]methyl acetate.
| Compound Name | [3-acetyloxy-6-[2-(1-methoxycyclohexyl)ethynyl]-3,6-dihydro-2H-pyran-2-yl]methyl acetate |
|---|---|
| PubChem CID | 16758928 |
| Molecular Formula | C19H26O6 |
| Molecular Weight | 350.41 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | [3-acetyloxy-6-[2-(1-methoxycyclohexyl)ethynyl]-3,6-dihydro-2H-pyran-2-yl]methyl acetate |
| SMILES | COC1(C#CC2C=CC(OC(C)=O)C(COC(C)=O)O2)CCCCC1 |
| InChI | InChI=1S/C19H26O6/c1-14(20)23-13-18-17(24-15(2)21)8-7-16(25-18)9-12-19(22-3)10-5-4-6-11-19/h7-8,16-18H,4-6,10-11,13H2,1-3H3 |
| InChIKey | BQIZFVANVXCUDO-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.41 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|