C16H19NO5 — CID 16758998
prop-2-enyl 2-[(methoxycarbonylamino)-phenylmethyl]-3-oxobutanoate (PubChem CID 16758998) has the molecular formula C16H19NO5 and a molecular weight of 305.33 g/mol. Its IUPAC name is prop-2-enyl 2-[(methoxycarbonylamino)-phenylmethyl]-3-oxobutanoate.
| Compound Name | prop-2-enyl 2-[(methoxycarbonylamino)-phenylmethyl]-3-oxobutanoate |
|---|---|
| PubChem CID | 16758998 |
| Molecular Formula | C16H19NO5 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | prop-2-enyl 2-[(methoxycarbonylamino)-phenylmethyl]-3-oxobutanoate |
| SMILES | C=CCOC(=O)C(C(C)=O)C(NC(=O)OC)c1ccccc1 |
| InChI | InChI=1S/C16H19NO5/c1-4-10-22-15(19)13(11(2)18)14(17-16(20)21-3)12-8-6-5-7-9-12/h4-9,13-14H,1,10H2,2-3H3,(H,17,20) |
| InChIKey | DQZXLTGWFHYSDY-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|