C9H16O — CID 16759050
2-ethyl-3-methyl-2,3,6,7-tetrahydrooxepine (PubChem CID 16759050) has the molecular formula C9H16O and a molecular weight of 140.23 g/mol. Its IUPAC name is 2-ethyl-3-methyl-2,3,6,7-tetrahydrooxepine.
| Compound Name | 2-ethyl-3-methyl-2,3,6,7-tetrahydrooxepine |
|---|---|
| PubChem CID | 16759050 |
| Molecular Formula | C9H16O |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 140.12 |
| IUPAC Name | 2-ethyl-3-methyl-2,3,6,7-tetrahydrooxepine |
| SMILES | CCC1OCCC=CC1C |
| InChI | InChI=1S/C9H16O/c1-3-9-8(2)6-4-5-7-10-9/h4,6,8-9H,3,5,7H2,1-2H3 |
| InChIKey | FELRTTYVNLIXOS-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|