About ethyl (2E)-7-hydroxy-6-methoxy-2,8-dimethylnona-2,8-dienoate
ethyl (2E)-7-hydroxy-6-methoxy-2,8-dimethylnona-2,8-dienoate (PubChem CID 16759083) has the molecular formula C14H24O4
and a molecular weight of 256.34 g/mol. Its IUPAC name is ethyl (2E)-7-hydroxy-6-methoxy-2,8-dimethylnona-2,8-dienoate.
Molecular Properties
| Compound Name | ethyl (2E)-7-hydroxy-6-methoxy-2,8-dimethylnona-2,8-dienoate |
| PubChem CID | 16759083 |
| Molecular Formula | C14H24O4 |
| Molecular Weight | 256.34 g/mol |
| Exact Mass | 256.17 |
| IUPAC Name | ethyl (2E)-7-hydroxy-6-methoxy-2,8-dimethylnona-2,8-dienoate |
| SMILES | C=C(C)C(O)C(CC/C=C(\C)C(=O)OCC)OC |
| InChI | InChI=1S/C14H24O4/c1-6-18-14(16)11(4)8-7-9-12(17-5)13(15)10(2)3/h8,12-13,15H,2,6-7,9H2,1,3-5H3/b11-8+ |
| InChIKey | KHZDYDPLAZHAJK-DHZHZOJOSA-N |
| XLogP | 2.23 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.34 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl (2E)-7-hydroxy-6-methoxy-2,8-dimethylnona-2,8-dienoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (2E)-7-hydroxy-6-methoxy-2,8-dimethylnona-2,8-dienoate?
The IUPAC name of ethyl (2E)-7-hydroxy-6-methoxy-2,8-dimethylnona-2,8-dienoate (CID 16759083) is ethyl (2E)-7-hydroxy-6-methoxy-2,8-dimethylnona-2,8-dienoate.
What is the SMILES notation for ethyl (2E)-7-hydroxy-6-methoxy-2,8-dimethylnona-2,8-dienoate?
The canonical SMILES for ethyl (2E)-7-hydroxy-6-methoxy-2,8-dimethylnona-2,8-dienoate is C=C(C)C(O)C(CC/C=C(\C)C(=O)OCC)OC.
What is the InChIKey of ethyl (2E)-7-hydroxy-6-methoxy-2,8-dimethylnona-2,8-dienoate?
The InChIKey is KHZDYDPLAZHAJK-DHZHZOJOSA-N. The full InChI is InChI=1S/C14H24O4/c1-6-18-14(16)11(4)8-7-9-12(17-5)13(15)10(2)3/h8,12-13,15H,2,6-7,9H2,1,3-5H3/b11-8+.
What are the key properties of ethyl (2E)-7-hydroxy-6-methoxy-2,8-dimethylnona-2,8-dienoate?
ethyl (2E)-7-hydroxy-6-methoxy-2,8-dimethylnona-2,8-dienoate has a molecular weight of 256.34 g/mol, XLogP of 2.23, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (2E)-7-hydroxy-6-methoxy-2,8-dimethylnona-2,8-dienoate is sourced from PubChem (CID 16759083), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).