C19H16Cl2O5 — CID 16759141
[6-(1,3-benzodioxol-5-yl)-3-(3,5-dichlorophenoxy)-3,6-dihydro-2H-pyran-2-yl]methanol (PubChem CID 16759141) has the molecular formula C19H16Cl2O5 and a molecular weight of 395.24 g/mol. Its IUPAC name is [6-(1,3-benzodioxol-5-yl)-3-(3,5-dichlorophenoxy)-3,6-dihydro-2H-pyran-2-yl]methanol.
| Compound Name | [6-(1,3-benzodioxol-5-yl)-3-(3,5-dichlorophenoxy)-3,6-dihydro-2H-pyran-2-yl]methanol |
|---|---|
| PubChem CID | 16759141 |
| Molecular Formula | C19H16Cl2O5 |
| Molecular Weight | 395.24 g/mol |
| Exact Mass | 394.04 |
| IUPAC Name | [6-(1,3-benzodioxol-5-yl)-3-(3,5-dichlorophenoxy)-3,6-dihydro-2H-pyran-2-yl]methanol |
| SMILES | OCC1OC(c2ccc3c(c2)OCO3)C=CC1Oc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C19H16Cl2O5/c20-12-6-13(21)8-14(7-12)25-17-4-3-15(26-19(17)9-22)11-1-2-16-18(5-11)24-10-23-16/h1-8,15,17,19,22H,9-10H2 |
| InChIKey | JONOAXKZHQFNEU-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.24 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|