About CID 167592467
CID 167592467 (PubChem CID 167592467) has the molecular formula C27H29Cl5FN2O8P3S
and a molecular weight of 830.79 g/mol.
Molecular Properties
| Compound Name | CID 167592467 |
| PubChem CID | 167592467 |
| Molecular Formula | C27H29Cl5FN2O8P3S |
| Molecular Weight | 830.79 g/mol |
| Exact Mass | 827.93 |
| IUPAC Name | — |
| SMILES | C#CCN(c1nc(-c2cc(C)c(OC)cc2Cl)c(C)s1)[C@@H](CC1CC1)c1ccc(COP(=O)(O)O)c(F)c1.O=P(Cl)(Cl)OP(=O)(Cl)Cl |
| InChI | InChI=1S/C27H29ClFN2O5PS.Cl4O3P2/c1-5-10-31(27-30-26(17(3)38-27)21-11-16(2)25(35-4)14-22(21)28)24(12-18-6-7-18)19-8-9-20(23(29)13-19)15-36-37(32,33)34;1-8(2,5)7-9(3,4)6/h1,8-9,11,13-14,18,24H,6-7,10,12,15H2,2-4H3,(H2,32,33,34);/t24-;/m0./s1 |
| InChIKey | IPMIBKQQSWOFBH-JIDHJSLPSA-N |
| XLogP | 10.99 |
| TPSA | 135.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 830.79 |
| LogP ≤ 5 | 10.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 167592467 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 167592467?
The IUPAC name of CID 167592467 (CID 167592467) is not available.
What is the SMILES notation for CID 167592467?
The canonical SMILES for CID 167592467 is C#CCN(c1nc(-c2cc(C)c(OC)cc2Cl)c(C)s1)[C@@H](CC1CC1)c1ccc(COP(=O)(O)O)c(F)c1.O=P(Cl)(Cl)OP(=O)(Cl)Cl.
What is the InChIKey of CID 167592467?
The InChIKey is IPMIBKQQSWOFBH-JIDHJSLPSA-N. The full InChI is InChI=1S/C27H29ClFN2O5PS.Cl4O3P2/c1-5-10-31(27-30-26(17(3)38-27)21-11-16(2)25(35-4)14-22(21)28)24(12-18-6-7-18)19-8-9-20(23(29)13-19)15-36-37(32,33)34;1-8(2,5)7-9(3,4)6/h1,8-9,11,13-14,18,24H,6-7,10,12,15H2,2-4H3,(H2,32,33,34);/t24-;/m0./s1.
What are the key properties of CID 167592467?
CID 167592467 has a molecular weight of 830.79 g/mol, XLogP of 10.99, 13 rotatable bonds, 2 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for CID 167592467 is sourced from PubChem (CID 167592467), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).