C26H25NO6S — CID 167592957
1-(4-methylphenyl)-4-[2-[3-(4-nitrophenyl)propanoyl]phenyl]sulfonylbutan-2-one (PubChem CID 167592957) has the molecular formula C26H25NO6S and a molecular weight of 479.55 g/mol. Its IUPAC name is 1-(4-methylphenyl)-4-[2-[3-(4-nitrophenyl)propanoyl]phenyl]sulfonylbutan-2-one.
| Compound Name | 1-(4-methylphenyl)-4-[2-[3-(4-nitrophenyl)propanoyl]phenyl]sulfonylbutan-2-one |
|---|---|
| PubChem CID | 167592957 |
| Molecular Formula | C26H25NO6S |
| Molecular Weight | 479.55 g/mol |
| Exact Mass | 479.14 |
| IUPAC Name | 1-(4-methylphenyl)-4-[2-[3-(4-nitrophenyl)propanoyl]phenyl]sulfonylbutan-2-one |
| SMILES | Cc1ccc(CC(=O)CCS(=O)(=O)c2ccccc2C(=O)CCc2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C26H25NO6S/c1-19-6-8-21(9-7-19)18-23(28)16-17-34(32,33)26-5-3-2-4-24(26)25(29)15-12-20-10-13-22(14-11-20)27(30)31/h2-11,13-14H,12,15-18H2,1H3 |
| InChIKey | CGLSWHFJLBISRP-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 111.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.55 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|