C14H16O3 — CID 167593010
(3R,4aR,10bR)-3-hydroxy-8-methyl-1,2,3,4,4a,10b-hexahydrobenzo[c]chromen-6-one (PubChem CID 167593010) has the molecular formula C14H16O3 and a molecular weight of 232.28 g/mol. Its IUPAC name is (3R,4aR,10bR)-3-hydroxy-8-methyl-1,2,3,4,4a,10b-hexahydrobenzo[c]chromen-6-one.
| Compound Name | (3R,4aR,10bR)-3-hydroxy-8-methyl-1,2,3,4,4a,10b-hexahydrobenzo[c]chromen-6-one |
|---|---|
| PubChem CID | 167593010 |
| Molecular Formula | C14H16O3 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.11 |
| IUPAC Name | (3R,4aR,10bR)-3-hydroxy-8-methyl-1,2,3,4,4a,10b-hexahydrobenzo[c]chromen-6-one |
| SMILES | Cc1ccc2c(c1)C(=O)O[C@@H]1C[C@H](O)CC[C@H]21 |
| InChI | InChI=1S/C14H16O3/c1-8-2-4-10-11-5-3-9(15)7-13(11)17-14(16)12(10)6-8/h2,4,6,9,11,13,15H,3,5,7H2,1H3/t9-,11-,13-/m1/s1 |
| InChIKey | SLLGPLWAXAYFPD-IRUJWGPZSA-N |
| XLogP | 2.16 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |