About (11Z,14Z)-icosa-11,14-dienamide
(11Z,14Z)-icosa-11,14-dienamide (PubChem CID 16759324) has the molecular formula C20H37NO
and a molecular weight of 307.52 g/mol. Its IUPAC name is (11Z,14Z)-icosa-11,14-dienamide.
Molecular Properties
| Compound Name | (11Z,14Z)-icosa-11,14-dienamide |
| PubChem CID | 16759324 |
| Molecular Formula | C20H37NO |
| Molecular Weight | 307.52 g/mol |
| Exact Mass | 307.29 |
| IUPAC Name | (11Z,14Z)-icosa-11,14-dienamide |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCCC(N)=O |
| InChI | InChI=1S/C20H37NO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22/h6-7,9-10H,2-5,8,11-19H2,1H3,(H2,21,22)/b7-6-,10-9- |
| InChIKey | NAVGEXCVGUBSOQ-HZJYTTRNSA-N |
| XLogP | 6.07 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 307.52 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (11Z,14Z)-icosa-11,14-dienamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (11Z,14Z)-icosa-11,14-dienamide?
The IUPAC name of (11Z,14Z)-icosa-11,14-dienamide (CID 16759324) is (11Z,14Z)-icosa-11,14-dienamide.
What is the SMILES notation for (11Z,14Z)-icosa-11,14-dienamide?
The canonical SMILES for (11Z,14Z)-icosa-11,14-dienamide is CCCCC/C=C\C/C=C\CCCCCCCCCC(N)=O.
What is the InChIKey of (11Z,14Z)-icosa-11,14-dienamide?
The InChIKey is NAVGEXCVGUBSOQ-HZJYTTRNSA-N. The full InChI is InChI=1S/C20H37NO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22/h6-7,9-10H,2-5,8,11-19H2,1H3,(H2,21,22)/b7-6-,10-9-.
What are the key properties of (11Z,14Z)-icosa-11,14-dienamide?
(11Z,14Z)-icosa-11,14-dienamide has a molecular weight of 307.52 g/mol, XLogP of 6.07, 16 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (11Z,14Z)-icosa-11,14-dienamide is sourced from PubChem (CID 16759324), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).