C30H45NO3 — CID 16759350
(7Z,10Z,13Z,16Z)-N-[2-(3,4-dihydroxyphenyl)ethyl]docosa-7,10,13,16-tetraenamide (PubChem CID 16759350) has the molecular formula C30H45NO3 and a molecular weight of 467.69 g/mol. Its IUPAC name is (7Z,10Z,13Z,16Z)-N-[2-(3,4-dihydroxyphenyl)ethyl]docosa-7,10,13,16-tetraenamide.
| Compound Name | (7Z,10Z,13Z,16Z)-N-[2-(3,4-dihydroxyphenyl)ethyl]docosa-7,10,13,16-tetraenamide |
|---|---|
| PubChem CID | 16759350 |
| Molecular Formula | C30H45NO3 |
| Molecular Weight | 467.69 g/mol |
| Exact Mass | 467.34 |
| IUPAC Name | (7Z,10Z,13Z,16Z)-N-[2-(3,4-dihydroxyphenyl)ethyl]docosa-7,10,13,16-tetraenamide |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\C/C=C\CCCCCC(=O)NCCc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C30H45NO3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-30(34)31-25-24-27-22-23-28(32)29(33)26-27/h6-7,9-10,12-13,15-16,22-23,26,32-33H,2-5,8,11,14,17-21,24-25H2,1H3,(H,31,34)/b7-6-,10-9-,13-12-,16-15- |
| InChIKey | UOCRCGASDRJYPD-DOFZRALJSA-N |
| XLogP | 7.68 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.69 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|