C23H19FN4O4S — CID 167593949
4-ethyl-3-[[2-(3-fluorophenyl)-5-(tetrazol-1-yl)phenyl]methylsulfonyl]benzoic acid (PubChem CID 167593949) has the molecular formula C23H19FN4O4S and a molecular weight of 466.49 g/mol. Its IUPAC name is 4-ethyl-3-[[2-(3-fluorophenyl)-5-(tetrazol-1-yl)phenyl]methylsulfonyl]benzoic acid.
| Compound Name | 4-ethyl-3-[[2-(3-fluorophenyl)-5-(tetrazol-1-yl)phenyl]methylsulfonyl]benzoic acid |
|---|---|
| PubChem CID | 167593949 |
| Molecular Formula | C23H19FN4O4S |
| Molecular Weight | 466.49 g/mol |
| Exact Mass | 466.11 |
| IUPAC Name | 4-ethyl-3-[[2-(3-fluorophenyl)-5-(tetrazol-1-yl)phenyl]methylsulfonyl]benzoic acid |
| SMILES | CCc1ccc(C(=O)O)cc1S(=O)(=O)Cc1cc(-n2cnnn2)ccc1-c1cccc(F)c1 |
| InChI | InChI=1S/C23H19FN4O4S/c1-2-15-6-7-17(23(29)30)12-22(15)33(31,32)13-18-11-20(28-14-25-26-27-28)8-9-21(18)16-4-3-5-19(24)10-16/h3-12,14H,2,13H2,1H3,(H,29,30) |
| InChIKey | LJGYIUIKYYVWON-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 115.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.49 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |