About N-benzyl-2,4-diphenyl-1,3-oxazol-5-amine
N-benzyl-2,4-diphenyl-1,3-oxazol-5-amine (PubChem CID 16759411) has the molecular formula C22H18N2O
and a molecular weight of 326.40 g/mol. Its IUPAC name is N-benzyl-2,4-diphenyl-1,3-oxazol-5-amine.
Molecular Properties
| Compound Name | N-benzyl-2,4-diphenyl-1,3-oxazol-5-amine |
| PubChem CID | 16759411 |
| Molecular Formula | C22H18N2O |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | N-benzyl-2,4-diphenyl-1,3-oxazol-5-amine |
| SMILES | c1ccc(CNc2oc(-c3ccccc3)nc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C22H18N2O/c1-4-10-17(11-5-1)16-23-22-20(18-12-6-2-7-13-18)24-21(25-22)19-14-8-3-9-15-19/h1-15,23H,16H2 |
| InChIKey | WLKDDMHPJDZPNA-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-benzyl-2,4-diphenyl-1,3-oxazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-2,4-diphenyl-1,3-oxazol-5-amine?
The IUPAC name of N-benzyl-2,4-diphenyl-1,3-oxazol-5-amine (CID 16759411) is N-benzyl-2,4-diphenyl-1,3-oxazol-5-amine.
What is the SMILES notation for N-benzyl-2,4-diphenyl-1,3-oxazol-5-amine?
The canonical SMILES for N-benzyl-2,4-diphenyl-1,3-oxazol-5-amine is c1ccc(CNc2oc(-c3ccccc3)nc2-c2ccccc2)cc1.
What is the InChIKey of N-benzyl-2,4-diphenyl-1,3-oxazol-5-amine?
The InChIKey is WLKDDMHPJDZPNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H18N2O/c1-4-10-17(11-5-1)16-23-22-20(18-12-6-2-7-13-18)24-21(25-22)19-14-8-3-9-15-19/h1-15,23H,16H2.
What are the key properties of N-benzyl-2,4-diphenyl-1,3-oxazol-5-amine?
N-benzyl-2,4-diphenyl-1,3-oxazol-5-amine has a molecular weight of 326.40 g/mol, XLogP of 5.62, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-2,4-diphenyl-1,3-oxazol-5-amine is sourced from PubChem (CID 16759411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).