About [5-bromo-3-(4-methoxyphenyl)-7-methyl-6,8-dioxoisochromen-7-yl] thiophene-2-carboxylate
[5-bromo-3-(4-methoxyphenyl)-7-methyl-6,8-dioxoisochromen-7-yl] thiophene-2-carboxylate (PubChem CID 16759450) has the molecular formula C22H15BrO6S
and a molecular weight of 487.33 g/mol. Its IUPAC name is [5-bromo-3-(4-methoxyphenyl)-7-methyl-6,8-dioxoisochromen-7-yl] thiophene-2-carboxylate.
Molecular Properties
| Compound Name | [5-bromo-3-(4-methoxyphenyl)-7-methyl-6,8-dioxoisochromen-7-yl] thiophene-2-carboxylate |
| PubChem CID | 16759450 |
| Molecular Formula | C22H15BrO6S |
| Molecular Weight | 487.33 g/mol |
| Exact Mass | 485.98 |
| IUPAC Name | [5-bromo-3-(4-methoxyphenyl)-7-methyl-6,8-dioxoisochromen-7-yl] thiophene-2-carboxylate |
| SMILES | COc1ccc(C2=CC3=C(Br)C(=O)C(C)(OC(=O)c4cccs4)C(=O)C3=CO2)cc1 |
| InChI | InChI=1S/C22H15BrO6S/c1-22(29-21(26)17-4-3-9-30-17)19(24)15-11-28-16(10-14(15)18(23)20(22)25)12-5-7-13(27-2)8-6-12/h3-11H,1-2H3 |
| InChIKey | BQNNNPNKHRUUJG-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 487.33 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze [5-bromo-3-(4-methoxyphenyl)-7-methyl-6,8-dioxoisochromen-7-yl] thiophene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-bromo-3-(4-methoxyphenyl)-7-methyl-6,8-dioxoisochromen-7-yl] thiophene-2-carboxylate?
The IUPAC name of [5-bromo-3-(4-methoxyphenyl)-7-methyl-6,8-dioxoisochromen-7-yl] thiophene-2-carboxylate (CID 16759450) is [5-bromo-3-(4-methoxyphenyl)-7-methyl-6,8-dioxoisochromen-7-yl] thiophene-2-carboxylate.
What is the SMILES notation for [5-bromo-3-(4-methoxyphenyl)-7-methyl-6,8-dioxoisochromen-7-yl] thiophene-2-carboxylate?
The canonical SMILES for [5-bromo-3-(4-methoxyphenyl)-7-methyl-6,8-dioxoisochromen-7-yl] thiophene-2-carboxylate is COc1ccc(C2=CC3=C(Br)C(=O)C(C)(OC(=O)c4cccs4)C(=O)C3=CO2)cc1.
What is the InChIKey of [5-bromo-3-(4-methoxyphenyl)-7-methyl-6,8-dioxoisochromen-7-yl] thiophene-2-carboxylate?
The InChIKey is BQNNNPNKHRUUJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H15BrO6S/c1-22(29-21(26)17-4-3-9-30-17)19(24)15-11-28-16(10-14(15)18(23)20(22)25)12-5-7-13(27-2)8-6-12/h3-11H,1-2H3.
What are the key properties of [5-bromo-3-(4-methoxyphenyl)-7-methyl-6,8-dioxoisochromen-7-yl] thiophene-2-carboxylate?
[5-bromo-3-(4-methoxyphenyl)-7-methyl-6,8-dioxoisochromen-7-yl] thiophene-2-carboxylate has a molecular weight of 487.33 g/mol, XLogP of 4.43, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [5-bromo-3-(4-methoxyphenyl)-7-methyl-6,8-dioxoisochromen-7-yl] thiophene-2-carboxylate is sourced from PubChem (CID 16759450), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).