C35H39N7O5 — CID 167595174
1-O-tert-butyl 3-O-methyl (3R,5S)-5-[[4-[6-(3,5-dimethyl-1,2-oxazol-4-yl)-1-phenylpyrrolo[2,3-b]pyridin-3-yl]-5-methylpyrimidin-2-yl]amino]piperidine-1,3-dicarboxylate (PubChem CID 167595174) has the molecular formula C35H39N7O5 and a molecular weight of 637.74 g/mol. Its IUPAC name is 1-O-tert-butyl 3-O-methyl (3R,5S)-5-[[4-[6-(3,5-dimethyl-1,2-oxazol-4-yl)-1-phenylpyrrolo[2,3-b]pyridin-3-yl]-5-methylpyrimidin-2-yl]amino]piperidine-1,3-dicarboxylate.
| Compound Name | 1-O-tert-butyl 3-O-methyl (3R,5S)-5-[[4-[6-(3,5-dimethyl-1,2-oxazol-4-yl)-1-phenylpyrrolo[2,3-b]pyridin-3-yl]-5-methylpyrimidin-2-yl]amino]piperidine-1,3-dicarboxylate |
|---|---|
| PubChem CID | 167595174 |
| Molecular Formula | C35H39N7O5 |
| Molecular Weight | 637.74 g/mol |
| Exact Mass | 637.30 |
| IUPAC Name | 1-O-tert-butyl 3-O-methyl (3R,5S)-5-[[4-[6-(3,5-dimethyl-1,2-oxazol-4-yl)-1-phenylpyrrolo[2,3-b]pyridin-3-yl]-5-methylpyrimidin-2-yl]amino]piperidine-1,3-dicarboxylate |
| SMILES | COC(=O)[C@@H]1C[C@H](Nc2ncc(C)c(-c3cn(-c4ccccc4)c4nc(-c5c(C)noc5C)ccc34)n2)CN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C35H39N7O5/c1-20-16-36-33(37-24-15-23(32(43)45-7)17-41(18-24)34(44)46-35(4,5)6)39-30(20)27-19-42(25-11-9-8-10-12-25)31-26(27)13-14-28(38-31)29-21(2)40-47-22(29)3/h8-14,16,19,23-24H,15,17-18H2,1-7H3,(H,36,37,39)/t23-,24+/m1/s1 |
| InChIKey | GUHRKGKIYVEYLT-RPWUZVMVSA-N |
| XLogP | 6.27 |
| TPSA | 137.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.74 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |