C44H84O4 — CID 167595712
2-methyl-6,6-dioctoxyhexan-3-one;(11Z,14Z)-2-methylicosa-11,14-dien-3-one (PubChem CID 167595712) has the molecular formula C44H84O4 and a molecular weight of 677.15 g/mol. Its IUPAC name is 2-methyl-6,6-dioctoxyhexan-3-one;(11Z,14Z)-2-methylicosa-11,14-dien-3-one.
| Compound Name | 2-methyl-6,6-dioctoxyhexan-3-one;(11Z,14Z)-2-methylicosa-11,14-dien-3-one |
|---|---|
| PubChem CID | 167595712 |
| Molecular Formula | C44H84O4 |
| Molecular Weight | 677.15 g/mol |
| Exact Mass | 676.64 |
| IUPAC Name | 2-methyl-6,6-dioctoxyhexan-3-one;(11Z,14Z)-2-methylicosa-11,14-dien-3-one |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)C(C)C.CCCCCCCCOC(CCC(=O)C(C)C)OCCCCCCCC |
| InChI | InChI=1S/C23H46O3.C21H38O/c1-5-7-9-11-13-15-19-25-23(18-17-22(24)21(3)4)26-20-16-14-12-10-8-6-2;1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-21(22)20(2)3/h21,23H,5-20H2,1-4H3;8-9,11-12,20H,4-7,10,13-19H2,1-3H3/b;9-8-,12-11- |
| InChIKey | JAQCXTTUVRBOKZ-LKRIWDHNSA-N |
| XLogP | 14.10 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.15 |
| LogP ≤ 5 | 14.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|