C14H22BF6N5O9 — CID 167596814
(3R,4S)-3-amino-4-(3-boronopropyl)-1-(diaminomethylidenecarbamoyl)pyrrolidine-3-carboxylic acid;bis(2,2,2-trifluoroacetic acid) (PubChem CID 167596814) has the molecular formula C14H22BF6N5O9 and a molecular weight of 529.16 g/mol. Its IUPAC name is (3R,4S)-3-amino-4-(3-boronopropyl)-1-(diaminomethylidenecarbamoyl)pyrrolidine-3-carboxylic acid;bis(2,2,2-trifluoroacetic acid).
| Compound Name | (3R,4S)-3-amino-4-(3-boronopropyl)-1-(diaminomethylidenecarbamoyl)pyrrolidine-3-carboxylic acid;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 167596814 |
| Molecular Formula | C14H22BF6N5O9 |
| Molecular Weight | 529.16 g/mol |
| Exact Mass | 529.14 |
| IUPAC Name | (3R,4S)-3-amino-4-(3-boronopropyl)-1-(diaminomethylidenecarbamoyl)pyrrolidine-3-carboxylic acid;bis(2,2,2-trifluoroacetic acid) |
| SMILES | NC(N)=NC(=O)N1C[C@H](CCCB(O)O)[C@](N)(C(=O)O)C1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C10H20BN5O5.2C2HF3O2/c12-8(13)15-9(19)16-4-6(2-1-3-11(20)21)10(14,5-16)7(17)18;2*3-2(4,5)1(6)7/h6,20-21H,1-5,14H2,(H,17,18)(H4,12,13,15,19);2*(H,6,7)/t6-,10-;;/m0../s1 |
| InChIKey | XOQQDOWDINLHIJ-IKSZAZRJSA-N |
| XLogP | -1.39 |
| TPSA | 263.09 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.16 |
| LogP ≤ 5 | -1.39 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|