About N-ethyl-2-methoxyethanesulfonamide;N-ethyloxane-4-sulfonamide
N-ethyl-2-methoxyethanesulfonamide;N-ethyloxane-4-sulfonamide (PubChem CID 167597024) has the molecular formula C12H28N2O6S2
and a molecular weight of 360.50 g/mol. Its IUPAC name is N-ethyl-2-methoxyethanesulfonamide;N-ethyloxane-4-sulfonamide.
Molecular Properties
| Compound Name | N-ethyl-2-methoxyethanesulfonamide;N-ethyloxane-4-sulfonamide |
| PubChem CID | 167597024 |
| Molecular Formula | C12H28N2O6S2 |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | N-ethyl-2-methoxyethanesulfonamide;N-ethyloxane-4-sulfonamide |
| SMILES | CCNS(=O)(=O)C1CCOCC1.CCNS(=O)(=O)CCOC |
| InChI | InChI=1S/C7H15NO3S.C5H13NO3S/c1-2-8-12(9,10)7-3-5-11-6-4-7;1-3-6-10(7,8)5-4-9-2/h7-8H,2-6H2,1H3;6H,3-5H2,1-2H3 |
| InChIKey | JFAWLKYDJZYZGQ-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-ethyl-2-methoxyethanesulfonamide;N-ethyloxane-4-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-2-methoxyethanesulfonamide;N-ethyloxane-4-sulfonamide?
The IUPAC name of N-ethyl-2-methoxyethanesulfonamide;N-ethyloxane-4-sulfonamide (CID 167597024) is N-ethyl-2-methoxyethanesulfonamide;N-ethyloxane-4-sulfonamide.
What is the SMILES notation for N-ethyl-2-methoxyethanesulfonamide;N-ethyloxane-4-sulfonamide?
The canonical SMILES for N-ethyl-2-methoxyethanesulfonamide;N-ethyloxane-4-sulfonamide is CCNS(=O)(=O)C1CCOCC1.CCNS(=O)(=O)CCOC.
What is the InChIKey of N-ethyl-2-methoxyethanesulfonamide;N-ethyloxane-4-sulfonamide?
The InChIKey is JFAWLKYDJZYZGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15NO3S.C5H13NO3S/c1-2-8-12(9,10)7-3-5-11-6-4-7;1-3-6-10(7,8)5-4-9-2/h7-8H,2-6H2,1H3;6H,3-5H2,1-2H3.
What are the key properties of N-ethyl-2-methoxyethanesulfonamide;N-ethyloxane-4-sulfonamide?
N-ethyl-2-methoxyethanesulfonamide;N-ethyloxane-4-sulfonamide has a molecular weight of 360.50 g/mol, XLogP of -0.32, 8 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-2-methoxyethanesulfonamide;N-ethyloxane-4-sulfonamide is sourced from PubChem (CID 167597024), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).