About 1-tert-butyl-5-methylidenepyrrolidin-2-one;2,2-dimethylpropane
1-tert-butyl-5-methylidenepyrrolidin-2-one;2,2-dimethylpropane (PubChem CID 167597515) has the molecular formula C14H27NO
and a molecular weight of 225.38 g/mol. Its IUPAC name is 1-tert-butyl-5-methylidenepyrrolidin-2-one;2,2-dimethylpropane.
Molecular Properties
| Compound Name | 1-tert-butyl-5-methylidenepyrrolidin-2-one;2,2-dimethylpropane |
| PubChem CID | 167597515 |
| Molecular Formula | C14H27NO |
| Molecular Weight | 225.38 g/mol |
| Exact Mass | 225.21 |
| IUPAC Name | 1-tert-butyl-5-methylidenepyrrolidin-2-one;2,2-dimethylpropane |
| SMILES | C=C1CCC(=O)N1C(C)(C)C.CC(C)(C)C |
| InChI | InChI=1S/C9H15NO.C5H12/c1-7-5-6-8(11)10(7)9(2,3)4;1-5(2,3)4/h1,5-6H2,2-4H3;1-4H3 |
| InChIKey | JGYIHOCXEMSSPZ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.38 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-tert-butyl-5-methylidenepyrrolidin-2-one;2,2-dimethylpropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butyl-5-methylidenepyrrolidin-2-one;2,2-dimethylpropane?
The IUPAC name of 1-tert-butyl-5-methylidenepyrrolidin-2-one;2,2-dimethylpropane (CID 167597515) is 1-tert-butyl-5-methylidenepyrrolidin-2-one;2,2-dimethylpropane.
What is the SMILES notation for 1-tert-butyl-5-methylidenepyrrolidin-2-one;2,2-dimethylpropane?
The canonical SMILES for 1-tert-butyl-5-methylidenepyrrolidin-2-one;2,2-dimethylpropane is C=C1CCC(=O)N1C(C)(C)C.CC(C)(C)C.
What is the InChIKey of 1-tert-butyl-5-methylidenepyrrolidin-2-one;2,2-dimethylpropane?
The InChIKey is JGYIHOCXEMSSPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NO.C5H12/c1-7-5-6-8(11)10(7)9(2,3)4;1-5(2,3)4/h1,5-6H2,2-4H3;1-4H3.
What are the key properties of 1-tert-butyl-5-methylidenepyrrolidin-2-one;2,2-dimethylpropane?
1-tert-butyl-5-methylidenepyrrolidin-2-one;2,2-dimethylpropane has a molecular weight of 225.38 g/mol, XLogP of 3.97, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butyl-5-methylidenepyrrolidin-2-one;2,2-dimethylpropane is sourced from PubChem (CID 167597515), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).