C31H30N4O9S — CID 16759756
trimethyl (1S,9R,15S)-8-benzyl-14-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]-8,12,14-triazatetracyclo[7.7.0.01,13.02,7]hexadeca-2,4,6,10,12-pentaene-10,11,15-tricarboxylate (PubChem CID 16759756) has the molecular formula C31H30N4O9S and a molecular weight of 634.67 g/mol. Its IUPAC name is trimethyl (1S,9R,15S)-8-benzyl-14-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]-8,12,14-triazatetracyclo[7.7.0.01,13.02,7]hexadeca-2,4,6,10,12-pentaene-10,11,15-tricarboxylate.
| Compound Name | trimethyl (1S,9R,15S)-8-benzyl-14-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]-8,12,14-triazatetracyclo[7.7.0.01,13.02,7]hexadeca-2,4,6,10,12-pentaene-10,11,15-tricarboxylate |
|---|---|
| PubChem CID | 16759756 |
| Molecular Formula | C31H30N4O9S |
| Molecular Weight | 634.67 g/mol |
| Exact Mass | 634.17 |
| IUPAC Name | trimethyl (1S,9R,15S)-8-benzyl-14-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]-8,12,14-triazatetracyclo[7.7.0.01,13.02,7]hexadeca-2,4,6,10,12-pentaene-10,11,15-tricarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)[C@@H]2N(Cc3ccccc3)c3ccccc3[C@@]23C[C@@H](C(=O)OC)N(S(=O)(=O)c2c(C)noc2C)C3=N1 |
| InChI | InChI=1S/C31H30N4O9S/c1-17-25(18(2)44-33-17)45(39,40)35-22(27(36)41-3)15-31-20-13-9-10-14-21(20)34(16-19-11-7-6-8-12-19)26(31)23(28(37)42-4)24(29(38)43-5)32-30(31)35/h6-14,22,26H,15-16H2,1-5H3/t22-,26-,31-/m0/s1 |
| InChIKey | JQGFPQPWGDXCRR-XHTHIGMCSA-N |
| XLogP | 2.57 |
| TPSA | 157.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.67 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|