C31H27N3O7S — CID 16759770
trimethyl (1S,9R,15S)-8-benzyl-14-(thiophene-2-carbonyl)-8,12,14-triazatetracyclo[7.7.0.01,13.02,7]hexadeca-2,4,6,10,12-pentaene-10,11,15-tricarboxylate (PubChem CID 16759770) has the molecular formula C31H27N3O7S and a molecular weight of 585.64 g/mol. Its IUPAC name is trimethyl (1S,9R,15S)-8-benzyl-14-(thiophene-2-carbonyl)-8,12,14-triazatetracyclo[7.7.0.01,13.02,7]hexadeca-2,4,6,10,12-pentaene-10,11,15-tricarboxylate.
| Compound Name | trimethyl (1S,9R,15S)-8-benzyl-14-(thiophene-2-carbonyl)-8,12,14-triazatetracyclo[7.7.0.01,13.02,7]hexadeca-2,4,6,10,12-pentaene-10,11,15-tricarboxylate |
|---|---|
| PubChem CID | 16759770 |
| Molecular Formula | C31H27N3O7S |
| Molecular Weight | 585.64 g/mol |
| Exact Mass | 585.16 |
| IUPAC Name | trimethyl (1S,9R,15S)-8-benzyl-14-(thiophene-2-carbonyl)-8,12,14-triazatetracyclo[7.7.0.01,13.02,7]hexadeca-2,4,6,10,12-pentaene-10,11,15-tricarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)[C@@H]2N(Cc3ccccc3)c3ccccc3[C@@]23C[C@@H](C(=O)OC)N(C(=O)c2cccs2)C3=N1 |
| InChI | InChI=1S/C31H27N3O7S/c1-39-27(36)21-16-31-19-12-7-8-13-20(19)33(17-18-10-5-4-6-11-18)25(31)23(28(37)40-2)24(29(38)41-3)32-30(31)34(21)26(35)22-14-9-15-42-22/h4-15,21,25H,16-17H2,1-3H3/t21-,25-,31-/m0/s1 |
| InChIKey | BFTIHRYROOTFRD-GKFGHWCMSA-N |
| XLogP | 3.47 |
| TPSA | 114.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.64 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|