C29H29N3O8 — CID 16759781
trimethyl (1S,9R,15S)-8-methyl-14-(2-phenylmethoxyacetyl)-8,12,14-triazatetracyclo[7.7.0.01,13.02,7]hexadeca-2,4,6,10,12-pentaene-10,11,15-tricarboxylate (PubChem CID 16759781) has the molecular formula C29H29N3O8 and a molecular weight of 547.56 g/mol. Its IUPAC name is trimethyl (1S,9R,15S)-8-methyl-14-(2-phenylmethoxyacetyl)-8,12,14-triazatetracyclo[7.7.0.01,13.02,7]hexadeca-2,4,6,10,12-pentaene-10,11,15-tricarboxylate.
| Compound Name | trimethyl (1S,9R,15S)-8-methyl-14-(2-phenylmethoxyacetyl)-8,12,14-triazatetracyclo[7.7.0.01,13.02,7]hexadeca-2,4,6,10,12-pentaene-10,11,15-tricarboxylate |
|---|---|
| PubChem CID | 16759781 |
| Molecular Formula | C29H29N3O8 |
| Molecular Weight | 547.56 g/mol |
| Exact Mass | 547.20 |
| IUPAC Name | trimethyl (1S,9R,15S)-8-methyl-14-(2-phenylmethoxyacetyl)-8,12,14-triazatetracyclo[7.7.0.01,13.02,7]hexadeca-2,4,6,10,12-pentaene-10,11,15-tricarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)[C@@H]2N(C)c3ccccc3[C@@]23C[C@@H](C(=O)OC)N(C(=O)COCc2ccccc2)C3=N1 |
| InChI | InChI=1S/C29H29N3O8/c1-31-19-13-9-8-12-18(19)29-14-20(25(34)37-2)32(21(33)16-40-15-17-10-6-5-7-11-17)28(29)30-23(27(36)39-4)22(24(29)31)26(35)38-3/h5-13,20,24H,14-16H2,1-4H3/t20-,24-,29-/m0/s1 |
| InChIKey | PTOKETCVROIEHH-LGONNFHISA-N |
| XLogP | 1.75 |
| TPSA | 124.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.56 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|