C24H24N4O9S — CID 16759811
trimethyl (1S,9R,15S)-14-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]-8,12,14-triazatetracyclo[7.7.0.01,13.02,7]hexadeca-2,4,6,10,12-pentaene-10,11,15-tricarboxylate (PubChem CID 16759811) has the molecular formula C24H24N4O9S and a molecular weight of 544.54 g/mol. Its IUPAC name is trimethyl (1S,9R,15S)-14-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]-8,12,14-triazatetracyclo[7.7.0.01,13.02,7]hexadeca-2,4,6,10,12-pentaene-10,11,15-tricarboxylate.
| Compound Name | trimethyl (1S,9R,15S)-14-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]-8,12,14-triazatetracyclo[7.7.0.01,13.02,7]hexadeca-2,4,6,10,12-pentaene-10,11,15-tricarboxylate |
|---|---|
| PubChem CID | 16759811 |
| Molecular Formula | C24H24N4O9S |
| Molecular Weight | 544.54 g/mol |
| Exact Mass | 544.13 |
| IUPAC Name | trimethyl (1S,9R,15S)-14-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]-8,12,14-triazatetracyclo[7.7.0.01,13.02,7]hexadeca-2,4,6,10,12-pentaene-10,11,15-tricarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)[C@@H]2Nc3ccccc3[C@@]23C[C@@H](C(=O)OC)N(S(=O)(=O)c2c(C)noc2C)C3=N1 |
| InChI | InChI=1S/C24H24N4O9S/c1-11-18(12(2)37-27-11)38(32,33)28-15(20(29)34-3)10-24-13-8-6-7-9-14(13)25-19(24)16(21(30)35-4)17(22(31)36-5)26-23(24)28/h6-9,15,19,25H,10H2,1-5H3/t15-,19-,24-/m0/s1 |
| InChIKey | KWCUCEAEAOXTKJ-KFSOKAEPSA-N |
| XLogP | 0.97 |
| TPSA | 166.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.54 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|