About (2S)-2-[(2S)-pyrrolidin-2-yl]but-3-yn-2-ol;sulfane
(2S)-2-[(2S)-pyrrolidin-2-yl]but-3-yn-2-ol;sulfane (PubChem CID 167598159) has the molecular formula C8H17NOS2
and a molecular weight of 207.36 g/mol. Its IUPAC name is (2S)-2-[(2S)-pyrrolidin-2-yl]but-3-yn-2-ol;sulfane.
Molecular Properties
| Compound Name | (2S)-2-[(2S)-pyrrolidin-2-yl]but-3-yn-2-ol;sulfane |
| PubChem CID | 167598159 |
| Molecular Formula | C8H17NOS2 |
| Molecular Weight | 207.36 g/mol |
| Exact Mass | 207.08 |
| IUPAC Name | (2S)-2-[(2S)-pyrrolidin-2-yl]but-3-yn-2-ol;sulfane |
| SMILES | C#C[C@](C)(O)[C@@H]1CCCN1.S.S |
| InChI | InChI=1S/C8H13NO.2H2S/c1-3-8(2,10)7-5-4-6-9-7;;/h1,7,9-10H,4-6H2,2H3;2*1H2/t7-,8-;;/m0../s1 |
| InChIKey | JJARDIXXOAKQPI-FOMWZSOGSA-N |
| XLogP | 0.35 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.36 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-[(2S)-pyrrolidin-2-yl]but-3-yn-2-ol;sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-[(2S)-pyrrolidin-2-yl]but-3-yn-2-ol;sulfane?
The IUPAC name of (2S)-2-[(2S)-pyrrolidin-2-yl]but-3-yn-2-ol;sulfane (CID 167598159) is (2S)-2-[(2S)-pyrrolidin-2-yl]but-3-yn-2-ol;sulfane.
What is the SMILES notation for (2S)-2-[(2S)-pyrrolidin-2-yl]but-3-yn-2-ol;sulfane?
The canonical SMILES for (2S)-2-[(2S)-pyrrolidin-2-yl]but-3-yn-2-ol;sulfane is C#C[C@](C)(O)[C@@H]1CCCN1.S.S.
What is the InChIKey of (2S)-2-[(2S)-pyrrolidin-2-yl]but-3-yn-2-ol;sulfane?
The InChIKey is JJARDIXXOAKQPI-FOMWZSOGSA-N. The full InChI is InChI=1S/C8H13NO.2H2S/c1-3-8(2,10)7-5-4-6-9-7;;/h1,7,9-10H,4-6H2,2H3;2*1H2/t7-,8-;;/m0../s1.
What are the key properties of (2S)-2-[(2S)-pyrrolidin-2-yl]but-3-yn-2-ol;sulfane?
(2S)-2-[(2S)-pyrrolidin-2-yl]but-3-yn-2-ol;sulfane has a molecular weight of 207.36 g/mol, XLogP of 0.35, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-[(2S)-pyrrolidin-2-yl]but-3-yn-2-ol;sulfane is sourced from PubChem (CID 167598159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).