C26H28N4O10S — CID 16759820
trimethyl (1S,9R,15S)-14-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]-4-methoxy-8-methyl-8,12,14-triazatetracyclo[7.7.0.01,13.02,7]hexadeca-2(7),3,5,10,12-pentaene-10,11,15-tricarboxylate (PubChem CID 16759820) has the molecular formula C26H28N4O10S and a molecular weight of 588.60 g/mol. Its IUPAC name is trimethyl (1S,9R,15S)-14-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]-4-methoxy-8-methyl-8,12,14-triazatetracyclo[7.7.0.01,13.02,7]hexadeca-2(7),3,5,10,12-pentaene-10,11,15-tricarboxylate.
| Compound Name | trimethyl (1S,9R,15S)-14-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]-4-methoxy-8-methyl-8,12,14-triazatetracyclo[7.7.0.01,13.02,7]hexadeca-2(7),3,5,10,12-pentaene-10,11,15-tricarboxylate |
|---|---|
| PubChem CID | 16759820 |
| Molecular Formula | C26H28N4O10S |
| Molecular Weight | 588.60 g/mol |
| Exact Mass | 588.15 |
| IUPAC Name | trimethyl (1S,9R,15S)-14-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]-4-methoxy-8-methyl-8,12,14-triazatetracyclo[7.7.0.01,13.02,7]hexadeca-2(7),3,5,10,12-pentaene-10,11,15-tricarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)[C@@H]2N(C)c3ccc(OC)cc3[C@@]23C[C@@H](C(=O)OC)N(S(=O)(=O)c2c(C)noc2C)C3=N1 |
| InChI | InChI=1S/C26H28N4O10S/c1-12-20(13(2)40-28-12)41(34,35)30-17(22(31)37-5)11-26-15-10-14(36-4)8-9-16(15)29(3)21(26)18(23(32)38-6)19(24(33)39-7)27-25(26)30/h8-10,17,21H,11H2,1-7H3/t17-,21-,26-/m0/s1 |
| InChIKey | TWTQINGPMKYPEJ-CWVVSJDFSA-N |
| XLogP | 1.00 |
| TPSA | 167.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.60 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|